C12H13N3O4S — CID 63922366
1-(1,1-dioxothian-3-yl)benzotriazole-5-carboxylic acid (PubChem CID 63922366) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)benzotriazole-5-carboxylic acid.
| Compound Name | 1-(1,1-dioxothian-3-yl)benzotriazole-5-carboxylic acid |
|---|---|
| PubChem CID | 63922366 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)benzotriazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nnn2C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13N3O4S/c16-12(17)8-3-4-11-10(6-8)13-14-15(11)9-2-1-5-20(18,19)7-9/h3-4,6,9H,1-2,5,7H2,(H,16,17) |
| InChIKey | JSOAHXWIYOAABK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |