C13H15NO4S — CID 113382464
1-(1,1-dioxothiolan-3-yl)-2,3-dihydroindole-6-carboxylic acid (PubChem CID 113382464) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2,3-dihydroindole-6-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2,3-dihydroindole-6-carboxylic acid |
|---|---|
| PubChem CID | 113382464 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2,3-dihydroindole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)N(C1CCS(=O)(=O)C1)CC2 |
| InChI | InChI=1S/C13H15NO4S/c15-13(16)10-2-1-9-3-5-14(12(9)7-10)11-4-6-19(17,18)8-11/h1-2,7,11H,3-6,8H2,(H,15,16) |
| InChIKey | RHTJSWMNAVZXME-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |