C15H20N2O3S — CID 63924125
N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 63924125) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 63924125 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)C1NCCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O3S/c18-15(17-12-5-3-9-21(19,20)10-12)14-13-6-2-1-4-11(13)7-8-16-14/h1-2,4,6,12,14,16H,3,5,7-10H2,(H,17,18) |
| InChIKey | TUKWZTRHBAEOHB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |