C13H20ClNO4S2 — CID 63926914
3-(5-methylhexan-2-ylsulfamoyl)benzenesulfonyl chloride (PubChem CID 63926914) has the molecular formula C13H20ClNO4S2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-(5-methylhexan-2-ylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 3-(5-methylhexan-2-ylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63926914 |
| Molecular Formula | C13H20ClNO4S2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 3-(5-methylhexan-2-ylsulfamoyl)benzenesulfonyl chloride |
| SMILES | CC(C)CCC(C)NS(=O)(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H20ClNO4S2/c1-10(2)7-8-11(3)15-21(18,19)13-6-4-5-12(9-13)20(14,16)17/h4-6,9-11,15H,7-8H2,1-3H3 |
| InChIKey | RNKUAEOMNFVJBF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |