C18H18N4OS4 — CID 6392890
2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide (PubChem CID 6392890) has the molecular formula C18H18N4OS4 and a molecular weight of 434.64 g/mol. Its IUPAC name is 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 6392890 |
| Molecular Formula | C18H18N4OS4 |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1nnc(SCc2ccc(C)cc2)s1)c1cccs1 |
| InChI | InChI=1S/C18H18N4OS4/c1-12-5-7-14(8-6-12)10-25-17-21-22-18(27-17)26-11-16(23)20-19-13(2)15-4-3-9-24-15/h3-9H,10-11H2,1-2H3,(H,20,23)/b19-13- |
| InChIKey | ORSFZLLVXZJFOM-UYRXBGFRSA-N |
| XLogP | 4.83 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|