C19H16Cl2N4OS3 — CID 3593206
2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide (PubChem CID 3593206) has the molecular formula C19H16Cl2N4OS3 and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3593206 |
| Molecular Formula | C19H16Cl2N4OS3 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(SCc2ccccc2)s1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N4OS3/c1-12(14-7-8-15(20)16(21)9-14)22-23-17(26)11-28-19-25-24-18(29-19)27-10-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,23,26) |
| InChIKey | HPIHSBBEQVWMAH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|