C15H13FO2S — CID 63935339
3-[2-[(2-fluorophenyl)methoxymethyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 63935339) has the molecular formula C15H13FO2S and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-[2-[(2-fluorophenyl)methoxymethyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(2-fluorophenyl)methoxymethyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63935339 |
| Molecular Formula | C15H13FO2S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-[2-[(2-fluorophenyl)methoxymethyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccsc1COCc1ccccc1F |
| InChI | InChI=1S/C15H13FO2S/c16-14-6-2-1-4-13(14)10-18-11-15-12(5-3-8-17)7-9-19-15/h1-2,4,6-7,9,17H,8,10-11H2 |
| InChIKey | UZYXLXYUBDCPOR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|