C16H16O3S — CID 107713889
3-[2-[[2-(2-hydroxyethyl)phenoxy]methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 107713889) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[2-[[2-(2-hydroxyethyl)phenoxy]methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[[2-(2-hydroxyethyl)phenoxy]methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 107713889 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[2-[[2-(2-hydroxyethyl)phenoxy]methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccsc1COc1ccccc1CCO |
| InChI | InChI=1S/C16H16O3S/c17-9-3-5-14-8-11-20-16(14)12-19-15-6-2-1-4-13(15)7-10-18/h1-2,4,6,8,11,17-18H,7,9-10,12H2 |
| InChIKey | CQVKHFVOWGELJL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|