C14H17NO5S — CID 63943336
5-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanylfuran-2-carboxylic acid (PubChem CID 63943336) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63943336 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanylfuran-2-carboxylic acid |
| SMILES | CCC(CC)N1C(=O)CC(Sc2ccc(C(=O)O)o2)C1=O |
| InChI | InChI=1S/C14H17NO5S/c1-3-8(4-2)15-11(16)7-10(13(15)17)21-12-6-5-9(20-12)14(18)19/h5-6,8,10H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | ASIIJYDBMQXXBG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|