C16H22N2O2S — CID 43638585
3-(4-amino-2-methylphenyl)sulfanyl-1-pentan-3-ylpyrrolidine-2,5-dione (PubChem CID 43638585) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-(4-amino-2-methylphenyl)sulfanyl-1-pentan-3-ylpyrrolidine-2,5-dione.
| Compound Name | 3-(4-amino-2-methylphenyl)sulfanyl-1-pentan-3-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43638585 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-(4-amino-2-methylphenyl)sulfanyl-1-pentan-3-ylpyrrolidine-2,5-dione |
| SMILES | CCC(CC)N1C(=O)CC(Sc2ccc(N)cc2C)C1=O |
| InChI | InChI=1S/C16H22N2O2S/c1-4-12(5-2)18-15(19)9-14(16(18)20)21-13-7-6-11(17)8-10(13)3/h6-8,12,14H,4-5,9,17H2,1-3H3 |
| InChIKey | VXGXOUPPFNDPFH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|