C15H15NO2S2 — CID 43638584
4-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfanyl]-3-methylaniline (PubChem CID 43638584) has the molecular formula C15H15NO2S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfanyl]-3-methylaniline.
| Compound Name | 4-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfanyl]-3-methylaniline |
|---|---|
| PubChem CID | 43638584 |
| Molecular Formula | C15H15NO2S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfanyl]-3-methylaniline |
| SMILES | Cc1cc(N)ccc1SC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H15NO2S2/c1-10-8-11(16)6-7-13(10)19-14-9-20(17,18)15-5-3-2-4-12(14)15/h2-8,14H,9,16H2,1H3 |
| InChIKey | AONOKVSZDRKCLI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|