C11H15NO2S2 — CID 43638575
4-(1,1-dioxothiolan-3-yl)sulfanyl-3-methylaniline (PubChem CID 43638575) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)sulfanyl-3-methylaniline.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)sulfanyl-3-methylaniline |
|---|---|
| PubChem CID | 43638575 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)sulfanyl-3-methylaniline |
| SMILES | Cc1cc(N)ccc1SC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO2S2/c1-8-6-9(12)2-3-11(8)15-10-4-5-16(13,14)7-10/h2-3,6,10H,4-5,7,12H2,1H3 |
| InChIKey | ZEMLQOFBEYNVIV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|