C12H14O3S2 — CID 64662312
1-[3-(1,1-dioxothiolan-3-yl)sulfanylphenyl]ethanone (PubChem CID 64662312) has the molecular formula C12H14O3S2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[3-(1,1-dioxothiolan-3-yl)sulfanylphenyl]ethanone.
| Compound Name | 1-[3-(1,1-dioxothiolan-3-yl)sulfanylphenyl]ethanone |
|---|---|
| PubChem CID | 64662312 |
| Molecular Formula | C12H14O3S2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-[3-(1,1-dioxothiolan-3-yl)sulfanylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(SC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H14O3S2/c1-9(13)10-3-2-4-11(7-10)16-12-5-6-17(14,15)8-12/h2-4,7,12H,5-6,8H2,1H3 |
| InChIKey | ZKGDPVTUBQRHNO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |