C10H15N3O4S2 — CID 63945641
N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxane-4-carboxamide (PubChem CID 63945641) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxane-4-carboxamide.
| Compound Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 63945641 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxane-4-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CCOCC2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C10H15N3O4S2/c1-6-9(19(11,15)16)18-10(12-6)13-8(14)7-2-4-17-5-3-7/h7H,2-5H2,1H3,(H2,11,15,16)(H,12,13,14) |
| InChIKey | UJHZLSGLHMESRO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |