C13H21N3O3S2 — CID 114458264
2-cycloheptyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)acetamide (PubChem CID 114458264) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-cycloheptyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-cycloheptyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 114458264 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-cycloheptyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1nc(NC(=O)CC2CCCCCC2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C13H21N3O3S2/c1-9-12(21(14,18)19)20-13(15-9)16-11(17)8-10-6-4-2-3-5-7-10/h10H,2-8H2,1H3,(H2,14,18,19)(H,15,16,17) |
| InChIKey | LWOMHORBZLIMIT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |