C9H13N3O4S2 — CID 63945642
N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxolane-3-carboxamide (PubChem CID 63945642) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxolane-3-carboxamide.
| Compound Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 63945642 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)oxolane-3-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CCOC2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C9H13N3O4S2/c1-5-8(18(10,14)15)17-9(11-5)12-7(13)6-2-3-16-4-6/h6H,2-4H2,1H3,(H2,10,14,15)(H,11,12,13) |
| InChIKey | VOVLFDVOQCRUOU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |