N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride

C6H12ClNO2S — CID 63955757

IUPACN-(cyclopropylmethyl)-N-ethylsulfamoyl chloride
SMILESCCN(CC1CC1)S(=O)(=O)Cl
InChIInChI=1S/C6H12ClNO2S/c1-2-8(11(7,9)10)5-6-3-4-6/h6H,2-5H2,1H3
InChIKeyIYWMQCZWSSPUNN-UHFFFAOYSA-N
MW197.69 g/mol
LogP1.20
Rot. Bonds4

About N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride

N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride (PubChem CID 63955757) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride.

Molecular Properties

Compound NameN-(cyclopropylmethyl)-N-ethylsulfamoyl chloride
PubChem CID63955757
Molecular FormulaC6H12ClNO2S
Molecular Weight197.69 g/mol
Exact Mass197.03
IUPAC NameN-(cyclopropylmethyl)-N-ethylsulfamoyl chloride
SMILESCCN(CC1CC1)S(=O)(=O)Cl
InChIInChI=1S/C6H12ClNO2S/c1-2-8(11(7,9)10)5-6-3-4-6/h6H,2-5H2,1H3
InChIKeyIYWMQCZWSSPUNN-UHFFFAOYSA-N
XLogP1.20
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.69
LogP ≤ 51.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-Methyl-N-(2-methylpropyl)sulfamoyl chloride
CID 43272017
N-butyl-N-ethylsulfamoyl chloride
CID 16769495
N-(cyclopropylmethyl)-N-propylsulfamoyl chloride
CID 16770038
N-(cyclopropylmethyl)-N-methylsulfamoyl chloride
CID 54594619
[Methyl(sulfamoyl)amino]methylcyclopropane
CID 60985019
[Methyl(sulfinato)amino]methylcyclopropane
CID 58392029
N-(cyclopropylmethyl)-N-ethylmethanesulfonamide
CID 64585729
[Propyl(sulfinato)amino]methylcyclopropane
CID 122647028
[Ethyl(sulfinato)amino]methylcyclopropane
CID 134590496
N-ethyl-N-(2-methylpropyl)sulfamoyl chloride
CID 43273594
N-methyl-N-(2-methylbutyl)sulfamoyl chloride
CID 43295660
N-(1-cyclopropylethyl)-N-methylsulfamoyl chloride
CID 43569022

Frequently Asked Questions

What is the IUPAC name of N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride?
The IUPAC name of N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride (CID 63955757) is N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride.
What is the SMILES notation for N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride?
The canonical SMILES for N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride is CCN(CC1CC1)S(=O)(=O)Cl.
What is the InChIKey of N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride?
The InChIKey is IYWMQCZWSSPUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO2S/c1-2-8(11(7,9)10)5-6-3-4-6/h6H,2-5H2,1H3.
What are the key properties of N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride?
N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride has a molecular weight of 197.69 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N-ethylsulfamoyl chloride is sourced from PubChem (CID 63955757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).