C15H15N3S — CID 63968062
2-propan-2-yl-4-quinolin-8-yl-1,3-thiazol-5-amine (PubChem CID 63968062) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-propan-2-yl-4-quinolin-8-yl-1,3-thiazol-5-amine.
| Compound Name | 2-propan-2-yl-4-quinolin-8-yl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 63968062 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-propan-2-yl-4-quinolin-8-yl-1,3-thiazol-5-amine |
| SMILES | CC(C)c1nc(-c2cccc3cccnc23)c(N)s1 |
| InChI | InChI=1S/C15H15N3S/c1-9(2)15-18-13(14(16)19-15)11-7-3-5-10-6-4-8-17-12(10)11/h3-9H,16H2,1-2H3 |
| InChIKey | UHIUQCSTJWBWHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |