C12H11N3 — CID 63969413
5-pyrazin-2-yl-2,3-dihydro-1H-indole (PubChem CID 63969413) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-pyrazin-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 5-pyrazin-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 63969413 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-pyrazin-2-yl-2,3-dihydro-1H-indole |
| SMILES | c1cnc(-c2ccc3c(c2)CCN3)cn1 |
| InChI | InChI=1S/C12H11N3/c1-2-11-10(3-4-14-11)7-9(1)12-8-13-5-6-15-12/h1-2,5-8,14H,3-4H2 |
| InChIKey | ZQULLCWXWJDZFD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |