C7H10N2O3 — CID 639724
ethyl 2-methyl-5-oxo-1H-pyrazole-3-carboxylate (PubChem CID 639724) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 2-methyl-5-oxo-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-oxo-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 639724 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethyl 2-methyl-5-oxo-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)[nH]n1C |
| InChI | InChI=1S/C7H10N2O3/c1-3-12-7(11)5-4-6(10)8-9(5)2/h4H,3H2,1-2H3,(H,8,10) |
| InChIKey | YMBWWRQULHMZBY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |