C6H8N2O3 — CID 12847993
ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate (PubChem CID 12847993) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 12847993 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C6H8N2O3/c1-2-11-6(10)4-3-5(9)8-7-4/h3H,2H2,1H3,(H2,7,8,9) |
| InChIKey | FGCPAXRNQIOISG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |