C21H21N3O4S4 — CID 6398896
3-[(2Z)-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid;pyridine (PubChem CID 6398896) has the molecular formula C21H21N3O4S4 and a molecular weight of 507.68 g/mol. Its IUPAC name is 3-[(2Z)-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid;pyridine.
| Compound Name | 3-[(2Z)-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid;pyridine |
|---|---|
| PubChem CID | 6398896 |
| Molecular Formula | C21H21N3O4S4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 3-[(2Z)-2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid;pyridine |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccccc3N2CCCS(=O)(=O)O)SC1=S.c1ccncc1 |
| InChI | InChI=1S/C16H16N2O4S4.C5H5N/c1-2-8-18-14(19)13(25-16(18)23)15-17(9-5-10-26(20,21)22)11-6-3-4-7-12(11)24-15;1-2-4-6-5-3-1/h2-4,6-7H,1,5,8-10H2,(H,20,21,22);1-5H/b15-13-; |
| InChIKey | XYPUTIQTFCMVBX-ZDCVYKBASA-N |
| XLogP | 4.17 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|