C13H12N2O3S — CID 63992161
2-[(6-methoxy-2-pyridinyl)methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 63992161) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-[(6-methoxy-2-pyridinyl)methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(6-methoxy-2-pyridinyl)methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63992161 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[(6-methoxy-2-pyridinyl)methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | COc1cccc(CSc2ncccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H12N2O3S/c1-18-11-6-2-4-9(15-11)8-19-12-10(13(16)17)5-3-7-14-12/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | WWKLOMXZDFSRNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |