C14H12N2O2 — CID 6399630
N-hydroxy-2-oxo-N',2-diphenylethanimidamide (PubChem CID 6399630) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-hydroxy-2-oxo-N',2-diphenylethanimidamide.
| Compound Name | N-hydroxy-2-oxo-N',2-diphenylethanimidamide |
|---|---|
| PubChem CID | 6399630 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-hydroxy-2-oxo-N',2-diphenylethanimidamide |
| SMILES | O=C(/C(=N/c1ccccc1)NO)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2/c17-13(11-7-3-1-4-8-11)14(16-18)15-12-9-5-2-6-10-12/h1-10,18H,(H,15,16) |
| InChIKey | ZJVQOULJQDAZOH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|