C10H14N4S — CID 63998729
2-[1-(thiophen-3-ylmethyl)triazol-4-yl]propan-2-amine (PubChem CID 63998729) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 2-[1-(thiophen-3-ylmethyl)triazol-4-yl]propan-2-amine.
| Compound Name | 2-[1-(thiophen-3-ylmethyl)triazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 63998729 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-[1-(thiophen-3-ylmethyl)triazol-4-yl]propan-2-amine |
| SMILES | CC(C)(N)c1cn(Cc2ccsc2)nn1 |
| InChI | InChI=1S/C10H14N4S/c1-10(2,11)9-6-14(13-12-9)5-8-3-4-15-7-8/h3-4,6-7H,5,11H2,1-2H3 |
| InChIKey | NOWXYGZDWWXQAD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |