C15H18ClN — CID 63999517
3-(4-chlorophenyl)-N-(2-methylbut-3-yn-2-yl)cyclobutan-1-amine (PubChem CID 63999517) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2-methylbut-3-yn-2-yl)cyclobutan-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N-(2-methylbut-3-yn-2-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 63999517 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2-methylbut-3-yn-2-yl)cyclobutan-1-amine |
| SMILES | C#CC(C)(C)NC1CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H18ClN/c1-4-15(2,3)17-14-9-12(10-14)11-5-7-13(16)8-6-11/h1,5-8,12,14,17H,9-10H2,2-3H3 |
| InChIKey | NAFVNDLFHGYMKV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|