C16H22ClN — CID 104530462
3-(4-chlorophenyl)-N-(1-cyclobutylethyl)cyclobutan-1-amine (PubChem CID 104530462) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(1-cyclobutylethyl)cyclobutan-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N-(1-cyclobutylethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 104530462 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(1-cyclobutylethyl)cyclobutan-1-amine |
| SMILES | CC(NC1CC(c2ccc(Cl)cc2)C1)C1CCC1 |
| InChI | InChI=1S/C16H22ClN/c1-11(12-3-2-4-12)18-16-9-14(10-16)13-5-7-15(17)8-6-13/h5-8,11-12,14,16,18H,2-4,9-10H2,1H3 |
| InChIKey | MUMNCLOQZXNSFF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |