C19H28BrN — CID 81390863
3-(4-bromophenyl)-N-[(1R)-1-cycloheptylethyl]cyclobutan-1-amine (PubChem CID 81390863) has the molecular formula C19H28BrN and a molecular weight of 350.34 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(1R)-1-cycloheptylethyl]cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-[(1R)-1-cycloheptylethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81390863 |
| Molecular Formula | C19H28BrN |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(1R)-1-cycloheptylethyl]cyclobutan-1-amine |
| SMILES | C[C@@H](NC1CC(c2ccc(Br)cc2)C1)C1CCCCCC1 |
| InChI | InChI=1S/C19H28BrN/c1-14(15-6-4-2-3-5-7-15)21-19-12-17(13-19)16-8-10-18(20)11-9-16/h8-11,14-15,17,19,21H,2-7,12-13H2,1H3/t14-,17?,19?/m1/s1 |
| InChIKey | NWZHMHALSQKLJP-ZCGYKAAXSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |