C18H26BrN — CID 81384574
3-(4-bromophenyl)-N-[(1R)-1-cyclohexylethyl]cyclobutan-1-amine (PubChem CID 81384574) has the molecular formula C18H26BrN and a molecular weight of 336.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(1R)-1-cyclohexylethyl]cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-[(1R)-1-cyclohexylethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81384574 |
| Molecular Formula | C18H26BrN |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(1R)-1-cyclohexylethyl]cyclobutan-1-amine |
| SMILES | C[C@@H](NC1CC(c2ccc(Br)cc2)C1)C1CCCCC1 |
| InChI | InChI=1S/C18H26BrN/c1-13(14-5-3-2-4-6-14)20-18-11-16(12-18)15-7-9-17(19)10-8-15/h7-10,13-14,16,18,20H,2-6,11-12H2,1H3/t13-,16?,18?/m1/s1 |
| InChIKey | ORRNKGXFICJHBJ-IMUUDWKMSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |