C13H20N2O3S — CID 63999798
N-(2,4-dimethylcyclohexyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 63999798) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(2,4-dimethylcyclohexyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63999798 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(=O)[nH]c2)C(C)C1 |
| InChI | InChI=1S/C13H20N2O3S/c1-9-3-5-12(10(2)7-9)15-19(17,18)11-4-6-13(16)14-8-11/h4,6,8-10,12,15H,3,5,7H2,1-2H3,(H,14,16) |
| InChIKey | YRGNBGJGNVODAA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |