C16H13FN6 — CID 6401719
(5-benzyl-8-fluoro-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine (PubChem CID 6401719) has the molecular formula C16H13FN6 and a molecular weight of 308.32 g/mol. Its IUPAC name is (5-benzyl-8-fluoro-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine.
| Compound Name | (5-benzyl-8-fluoro-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
|---|---|
| PubChem CID | 6401719 |
| Molecular Formula | C16H13FN6 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (5-benzyl-8-fluoro-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
| SMILES | NNc1nnc2c3cc(F)ccc3n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C16H13FN6/c17-11-6-7-13-12(8-11)14-15(19-16(20-18)22-21-14)23(13)9-10-4-2-1-3-5-10/h1-8H,9,18H2,(H,19,20,22) |
| InChIKey | QPWQDQPRXBGKND-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|