C19H16Cl2N4O — CID 6405139
3,6-bis(4-chlorophenyl)-N-propan-2-yl-1,2,4-triazine-5-carboxamide (PubChem CID 6405139) has the molecular formula C19H16Cl2N4O and a molecular weight of 387.27 g/mol. Its IUPAC name is 3,6-bis(4-chlorophenyl)-N-propan-2-yl-1,2,4-triazine-5-carboxamide.
| Compound Name | 3,6-bis(4-chlorophenyl)-N-propan-2-yl-1,2,4-triazine-5-carboxamide |
|---|---|
| PubChem CID | 6405139 |
| Molecular Formula | C19H16Cl2N4O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 3,6-bis(4-chlorophenyl)-N-propan-2-yl-1,2,4-triazine-5-carboxamide |
| SMILES | CC(C)NC(=O)c1nc(-c2ccc(Cl)cc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O/c1-11(2)22-19(26)17-16(12-3-7-14(20)8-4-12)24-25-18(23-17)13-5-9-15(21)10-6-13/h3-11H,1-2H3,(H,22,26) |
| InChIKey | BBEVSLRQVZTVJM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |