C18H16BrClN4O — CID 6405717
3-[[6-(4-bromophenyl)-3-(4-chlorophenyl)-1,2,4-triazin-5-yl]amino]propan-1-ol (PubChem CID 6405717) has the molecular formula C18H16BrClN4O and a molecular weight of 419.71 g/mol. Its IUPAC name is 3-[[6-(4-bromophenyl)-3-(4-chlorophenyl)-1,2,4-triazin-5-yl]amino]propan-1-ol.
| Compound Name | 3-[[6-(4-bromophenyl)-3-(4-chlorophenyl)-1,2,4-triazin-5-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 6405717 |
| Molecular Formula | C18H16BrClN4O |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 3-[[6-(4-bromophenyl)-3-(4-chlorophenyl)-1,2,4-triazin-5-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc(-c2ccc(Cl)cc2)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrClN4O/c19-14-6-2-12(3-7-14)16-18(21-10-1-11-25)22-17(24-23-16)13-4-8-15(20)9-5-13/h2-9,25H,1,10-11H2,(H,21,22,24) |
| InChIKey | YAPHWQFSXRJHAD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|