C22H21N5O5S — CID 6408510
1-[(6R)-3-methylsulfanyl-6-(5-nitro-2-propoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6408510) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is 1-[(6R)-3-methylsulfanyl-6-(5-nitro-2-propoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6R)-3-methylsulfanyl-6-(5-nitro-2-propoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6408510 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-[(6R)-3-methylsulfanyl-6-(5-nitro-2-propoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCOc1ccc([N+](=O)[O-])cc1[C@H]1Oc2nc(SC)nnc2-c2ccccc2N1C(C)=O |
| InChI | InChI=1S/C22H21N5O5S/c1-4-11-31-18-10-9-14(27(29)30)12-16(18)21-26(13(2)28)17-8-6-5-7-15(17)19-20(32-21)23-22(33-3)25-24-19/h5-10,12,21H,4,11H2,1-3H3/t21-/m1/s1 |
| InChIKey | PTOFXQSSRVPHAB-OAQYLSRUSA-N |
| XLogP | 4.40 |
| TPSA | 120.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|