C22H19N5O6S — CID 45037765
[2-(7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)-4-nitrophenyl] acetate (PubChem CID 45037765) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is [2-(7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)-4-nitrophenyl] acetate.
| Compound Name | [2-(7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 45037765 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [2-(7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)-4-nitrophenyl] acetate |
| SMILES | CCSc1nnc2c(n1)OC(c1cc([N+](=O)[O-])ccc1OC(C)=O)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H19N5O6S/c1-4-34-22-23-20-19(24-25-22)15-7-5-6-8-17(15)26(12(2)28)21(33-20)16-11-14(27(30)31)9-10-18(16)32-13(3)29/h5-11,21H,4H2,1-3H3 |
| InChIKey | NOJCAOMULLVJPJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 137.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|