C21H17N5O6S — CID 2895567
1-[3-ethylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 2895567) has the molecular formula C21H17N5O6S and a molecular weight of 467.46 g/mol. Its IUPAC name is 1-[3-ethylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[3-ethylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 2895567 |
| Molecular Formula | C21H17N5O6S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 1-[3-ethylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCSc1nnc2c(n1)OC(c1cc3c(cc1[N+](=O)[O-])OCO3)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H17N5O6S/c1-3-33-21-22-19-18(23-24-21)12-6-4-5-7-14(12)25(11(2)27)20(32-19)13-8-16-17(31-10-30-16)9-15(13)26(28)29/h4-9,20H,3,10H2,1-2H3 |
| InChIKey | OCNZOGNJDMQRDX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 129.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|