C25H23F2N4+ — CID 6408854
1-(4-benzylpiperazin-4-ium-1-yl)-4-(3,4-difluorophenyl)phthalazine (PubChem CID 6408854) has the molecular formula C25H23F2N4+ and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-4-ium-1-yl)-4-(3,4-difluorophenyl)phthalazine.
| Compound Name | 1-(4-benzylpiperazin-4-ium-1-yl)-4-(3,4-difluorophenyl)phthalazine |
|---|---|
| PubChem CID | 6408854 |
| Molecular Formula | C25H23F2N4+ |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-(4-benzylpiperazin-4-ium-1-yl)-4-(3,4-difluorophenyl)phthalazine |
| SMILES | Fc1ccc(-c2nnc(N3CC[NH+](Cc4ccccc4)CC3)c3ccccc23)cc1F |
| InChI | InChI=1S/C25H22F2N4/c26-22-11-10-19(16-23(22)27)24-20-8-4-5-9-21(20)25(29-28-24)31-14-12-30(13-15-31)17-18-6-2-1-3-7-18/h1-11,16H,12-15,17H2/p+1 |
| InChIKey | FEZCILATBBHRBL-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |