C20H18N6O4S — CID 6411042
2-[(6,8-dimethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 6411042) has the molecular formula C20H18N6O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[(6,8-dimethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(6,8-dimethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 6411042 |
| Molecular Formula | C20H18N6O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[(6,8-dimethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc3c(n2)[nH]c2c(C)cc(C)cc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N6O4S/c1-10-6-11(2)17-13(7-10)18-19(22-17)23-20(25-24-18)31-9-16(27)21-14-5-4-12(30-3)8-15(14)26(28)29/h4-8H,9H2,1-3H3,(H,21,27)(H,22,23,25) |
| InChIKey | JILXTEQCEVSUOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|