C22H18N4O2S — CID 6414725
1-(3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)naphthalen-2-ol (PubChem CID 6414725) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-(3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)naphthalen-2-ol.
| Compound Name | 1-(3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 6414725 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-(3-ethylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)naphthalen-2-ol |
| SMILES | CCSc1nnc2c(n1)OC(c1c(O)ccc3ccccc13)Nc1ccccc1-2 |
| InChI | InChI=1S/C22H18N4O2S/c1-2-29-22-24-21-19(25-26-22)15-9-5-6-10-16(15)23-20(28-21)18-14-8-4-3-7-13(14)11-12-17(18)27/h3-12,20,23,27H,2H2,1H3 |
| InChIKey | UYMPJJAHTXDARR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|