C19H17N5O2 — CID 6416835
3-ethoxy-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide (PubChem CID 6416835) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3-ethoxy-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide.
| Compound Name | 3-ethoxy-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
|---|---|
| PubChem CID | 6416835 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-ethoxy-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
| SMILES | CCOc1cccc(C(=O)Nc2nnc3c(n2)[nH]c2ccc(C)cc23)c1 |
| InChI | InChI=1S/C19H17N5O2/c1-3-26-13-6-4-5-12(10-13)18(25)22-19-21-17-16(23-24-19)14-9-11(2)7-8-15(14)20-17/h4-10H,3H2,1-2H3,(H2,20,21,22,24,25) |
| InChIKey | FWQRUCULFPBGAQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |