C15H14F6O4 — CID 6422528
1-O-(3,4-dimethylphenyl) 5-O-ethyl 2,2,3,3,4,4-hexafluoropentanedioate (PubChem CID 6422528) has the molecular formula C15H14F6O4 and a molecular weight of 372.26 g/mol. Its IUPAC name is 1-O-(3,4-dimethylphenyl) 5-O-ethyl 2,2,3,3,4,4-hexafluoropentanedioate.
| Compound Name | 1-O-(3,4-dimethylphenyl) 5-O-ethyl 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| PubChem CID | 6422528 |
| Molecular Formula | C15H14F6O4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-O-(3,4-dimethylphenyl) 5-O-ethyl 2,2,3,3,4,4-hexafluoropentanedioate |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H14F6O4/c1-4-24-11(22)13(16,17)15(20,21)14(18,19)12(23)25-10-6-5-8(2)9(3)7-10/h5-7H,4H2,1-3H3 |
| InChIKey | HJVUIYPFIXOEMZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|