C14H20N2O3 — CID 57124307
(3,4-dimethylphenyl) (2S)-2-amino-2-carbamoyl-3-methylbutanoate (PubChem CID 57124307) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3,4-dimethylphenyl) (2S)-2-amino-2-carbamoyl-3-methylbutanoate.
| Compound Name | (3,4-dimethylphenyl) (2S)-2-amino-2-carbamoyl-3-methylbutanoate |
|---|---|
| PubChem CID | 57124307 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (3,4-dimethylphenyl) (2S)-2-amino-2-carbamoyl-3-methylbutanoate |
| SMILES | Cc1ccc(OC(=O)[C@@](N)(C(N)=O)C(C)C)cc1C |
| InChI | InChI=1S/C14H20N2O3/c1-8(2)14(16,12(15)17)13(18)19-11-6-5-9(3)10(4)7-11/h5-8H,16H2,1-4H3,(H2,15,17)/t14-/m0/s1 |
| InChIKey | NLNVJWKINWWCCW-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|