C14H11ClN2O3S — CID 6423275
4-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)benzenesulfonamide (PubChem CID 6423275) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 4-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 6423275 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)benzenesulfonamide |
| SMILES | O=C1Cc2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2N1 |
| InChI | InChI=1S/C14H11ClN2O3S/c15-10-4-6-11(7-5-10)21(19,20)17-12-3-1-2-9-8-13(18)16-14(9)12/h1-7,17H,8H2,(H,16,18) |
| InChIKey | HUFRYASGIKTVGP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |