C12H9ClN2O3S2 — CID 166369413
2-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-3-sulfonamide (PubChem CID 166369413) has the molecular formula C12H9ClN2O3S2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-3-sulfonamide.
| Compound Name | 2-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 166369413 |
| Molecular Formula | C12H9ClN2O3S2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-chloro-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-3-sulfonamide |
| SMILES | O=C1Cc2cccc(NS(=O)(=O)c3ccsc3Cl)c2N1 |
| InChI | InChI=1S/C12H9ClN2O3S2/c13-12-9(4-5-19-12)20(17,18)15-8-3-1-2-7-6-10(16)14-11(7)8/h1-5,15H,6H2,(H,14,16) |
| InChIKey | GUDADEKJJAHSFY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |