About 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide
3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide (PubChem CID 166369387) has the molecular formula C13H12N2O4S2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide |
| PubChem CID | 166369387 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccsc1S(=O)(=O)Nc1cccc2c1NC(=O)C2 |
| InChI | InChI=1S/C13H12N2O4S2/c1-19-10-5-6-20-13(10)21(17,18)15-9-4-2-3-8-7-11(16)14-12(8)9/h2-6,15H,7H2,1H3,(H,14,16) |
| InChIKey | DZZQLCQSJPZNPM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide?
The IUPAC name of 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide (CID 166369387) is 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide?
The canonical SMILES for 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide is COc1ccsc1S(=O)(=O)Nc1cccc2c1NC(=O)C2.
What is the InChIKey of 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide?
The InChIKey is DZZQLCQSJPZNPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4S2/c1-19-10-5-6-20-13(10)21(17,18)15-9-4-2-3-8-7-11(16)14-12(8)9/h2-6,15H,7H2,1H3,(H,14,16).
What are the key properties of 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide?
3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide has a molecular weight of 324.38 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-(2-oxo-1,3-dihydroindol-7-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 166369387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).