C15H14BrNOS — CID 6424216
1-(4-bromophenyl)-2-(2,4-dimethyl-6-sulfanylidene-1-pyridinyl)ethanone (PubChem CID 6424216) has the molecular formula C15H14BrNOS and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2,4-dimethyl-6-sulfanylidene-1-pyridinyl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(2,4-dimethyl-6-sulfanylidene-1-pyridinyl)ethanone |
|---|---|
| PubChem CID | 6424216 |
| Molecular Formula | C15H14BrNOS |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2,4-dimethyl-6-sulfanylidene-1-pyridinyl)ethanone |
| SMILES | Cc1cc(C)n(CC(=O)c2ccc(Br)cc2)c(=S)c1 |
| InChI | InChI=1S/C15H14BrNOS/c1-10-7-11(2)17(15(19)8-10)9-14(18)12-3-5-13(16)6-4-12/h3-8H,9H2,1-2H3 |
| InChIKey | DVJLFNZDDKCFCU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|