C9H13N3O4 — CID 642655
(2S)-2-amino-5-(2,4-dioxopyrimidin-1-yl)pentanoic acid (PubChem CID 642655) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2S)-2-amino-5-(2,4-dioxopyrimidin-1-yl)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(2,4-dioxopyrimidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 642655 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (2S)-2-amino-5-(2,4-dioxopyrimidin-1-yl)pentanoic acid |
| SMILES | N[C@@H](CCCn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C9H13N3O4/c10-6(8(14)15)2-1-4-12-5-3-7(13)11-9(12)16/h3,5-6H,1-2,4,10H2,(H,14,15)(H,11,13,16)/t6-/m0/s1 |
| InChIKey | IOBNGWHKQIMVAT-LURJTMIESA-N |
| XLogP | -1.27 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |