C11H24O4Si2 — CID 6427164
(3R,5S)-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one (PubChem CID 6427164) has the molecular formula C11H24O4Si2 and a molecular weight of 276.48 g/mol. Its IUPAC name is (3R,5S)-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one.
| Compound Name | (3R,5S)-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 6427164 |
| Molecular Formula | C11H24O4Si2 |
| Molecular Weight | 276.48 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (3R,5S)-3-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one |
| SMILES | C[Si](C)(C)OC[C@@H]1C[C@@H](O[Si](C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C11H24O4Si2/c1-16(2,3)13-8-9-7-10(11(12)14-9)15-17(4,5)6/h9-10H,7-8H2,1-6H3/t9-,10+/m0/s1 |
| InChIKey | PMPOGQLSXIFUBJ-VHSXEESVSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|