C33H60O2Si2 — CID 6427406
[10,13-dimethyl-17-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane (PubChem CID 6427406) has the molecular formula C33H60O2Si2 and a molecular weight of 545.01 g/mol. Its IUPAC name is [10,13-dimethyl-17-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane.
| Compound Name | [10,13-dimethyl-17-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 6427406 |
| Molecular Formula | C33H60O2Si2 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | [10,13-dimethyl-17-[(2S)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
| SMILES | C[C@@H](CCCC(C)(C)O[Si](C)(C)C)C1CCC2C3CCC4=CC(O[Si](C)(C)C)=CCC4(C)C3CCC21C |
| InChI | InChI=1S/C33H60O2Si2/c1-24(13-12-20-31(2,3)35-37(9,10)11)28-16-17-29-27-15-14-25-23-26(34-36(6,7)8)18-21-32(25,4)30(27)19-22-33(28,29)5/h18,23-24,27-30H,12-17,19-22H2,1-11H3/t24-,27?,28?,29?,30?,32?,33?/m0/s1 |
| InChIKey | PVFLZIUPQZDUOQ-VVBYMBAGSA-N |
| XLogP | 10.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|