C17H20Cl8O8 — CID 6431955
[3-(2,2-dichloropropanoyloxy)-2,2-bis(2,2-dichloropropanoyloxymethyl)propyl] 2,2-dichloropropanoate (PubChem CID 6431955) has the molecular formula C17H20Cl8O8 and a molecular weight of 635.96 g/mol. Its IUPAC name is [3-(2,2-dichloropropanoyloxy)-2,2-bis(2,2-dichloropropanoyloxymethyl)propyl] 2,2-dichloropropanoate.
| Compound Name | [3-(2,2-dichloropropanoyloxy)-2,2-bis(2,2-dichloropropanoyloxymethyl)propyl] 2,2-dichloropropanoate |
|---|---|
| PubChem CID | 6431955 |
| Molecular Formula | C17H20Cl8O8 |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 631.87 |
| IUPAC Name | [3-(2,2-dichloropropanoyloxy)-2,2-bis(2,2-dichloropropanoyloxymethyl)propyl] 2,2-dichloropropanoate |
| SMILES | CC(Cl)(Cl)C(=O)OCC(COC(=O)C(C)(Cl)Cl)(COC(=O)C(C)(Cl)Cl)COC(=O)C(C)(Cl)Cl |
| InChI | InChI=1S/C17H20Cl8O8/c1-13(18,19)9(26)30-5-17(6-31-10(27)14(2,20)21,7-32-11(28)15(3,22)23)8-33-12(29)16(4,24)25/h5-8H2,1-4H3 |
| InChIKey | WOKUVVRQHHYMGQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|